C20H27N3O6S — CID 5210625
methyl 2-[[(3,5-dimethoxyphenyl)carbamoyl-(3-ethoxypropyl)amino]methyl]-1,3-thiazole-4-carboxylate (PubChem CID 5210625) has the molecular formula C20H27N3O6S and a molecular weight of 437.52 g/mol. Its IUPAC name is methyl 2-[[(3,5-dimethoxyphenyl)carbamoyl-(3-ethoxypropyl)amino]methyl]-1,3-thiazole-4-carboxylate.
| Compound Name | methyl 2-[[(3,5-dimethoxyphenyl)carbamoyl-(3-ethoxypropyl)amino]methyl]-1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 5210625 |
| Molecular Formula | C20H27N3O6S |
| Molecular Weight | 437.52 g/mol |
| Exact Mass | 437.16 |
| IUPAC Name | methyl 2-[[(3,5-dimethoxyphenyl)carbamoyl-(3-ethoxypropyl)amino]methyl]-1,3-thiazole-4-carboxylate |
| SMILES | CCOCCCN(Cc1nc(C(=O)OC)cs1)C(=O)Nc1cc(OC)cc(OC)c1 |
| InChI | InChI=1S/C20H27N3O6S/c1-5-29-8-6-7-23(12-18-22-17(13-30-18)19(24)28-4)20(25)21-14-9-15(26-2)11-16(10-14)27-3/h9-11,13H,5-8,12H2,1-4H3,(H,21,25) |
| InChIKey | DNPNELWZZRQGTE-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 99.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.52 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|