C15H23N3O6S — CID 4687143
methyl 2-[[(2-ethoxy-2-oxoethyl)carbamoyl-(3-methoxypropyl)amino]methyl]-1,3-thiazole-4-carboxylate (PubChem CID 4687143) has the molecular formula C15H23N3O6S and a molecular weight of 373.43 g/mol. Its IUPAC name is methyl 2-[[(2-ethoxy-2-oxoethyl)carbamoyl-(3-methoxypropyl)amino]methyl]-1,3-thiazole-4-carboxylate.
| Compound Name | methyl 2-[[(2-ethoxy-2-oxoethyl)carbamoyl-(3-methoxypropyl)amino]methyl]-1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 4687143 |
| Molecular Formula | C15H23N3O6S |
| Molecular Weight | 373.43 g/mol |
| Exact Mass | 373.13 |
| IUPAC Name | methyl 2-[[(2-ethoxy-2-oxoethyl)carbamoyl-(3-methoxypropyl)amino]methyl]-1,3-thiazole-4-carboxylate |
| SMILES | CCOC(=O)CNC(=O)N(CCCOC)Cc1nc(C(=O)OC)cs1 |
| InChI | InChI=1S/C15H23N3O6S/c1-4-24-13(19)8-16-15(21)18(6-5-7-22-2)9-12-17-11(10-25-12)14(20)23-3/h10H,4-9H2,1-3H3,(H,16,21) |
| InChIKey | GPTGXIPBINVMSD-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 107.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.43 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|