C16H27N3O3S — CID 42766914
methyl 2-[[tert-butylcarbamoyl(pentyl)amino]methyl]-1,3-thiazole-4-carboxylate (PubChem CID 42766914) has the molecular formula C16H27N3O3S and a molecular weight of 341.48 g/mol. Its IUPAC name is methyl 2-[[tert-butylcarbamoyl(pentyl)amino]methyl]-1,3-thiazole-4-carboxylate.
| Compound Name | methyl 2-[[tert-butylcarbamoyl(pentyl)amino]methyl]-1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 42766914 |
| Molecular Formula | C16H27N3O3S |
| Molecular Weight | 341.48 g/mol |
| Exact Mass | 341.18 |
| IUPAC Name | methyl 2-[[tert-butylcarbamoyl(pentyl)amino]methyl]-1,3-thiazole-4-carboxylate |
| SMILES | CCCCCN(Cc1nc(C(=O)OC)cs1)C(=O)NC(C)(C)C |
| InChI | InChI=1S/C16H27N3O3S/c1-6-7-8-9-19(15(21)18-16(2,3)4)10-13-17-12(11-23-13)14(20)22-5/h11H,6-10H2,1-5H3,(H,18,21) |
| InChIKey | CLBOKFFOUSTXMR-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.48 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|