C19H25N3O3S — CID 42766922
methyl 2-[[(2-methylphenyl)carbamoyl-pentylamino]methyl]-1,3-thiazole-4-carboxylate (PubChem CID 42766922) has the molecular formula C19H25N3O3S and a molecular weight of 375.49 g/mol. Its IUPAC name is methyl 2-[[(2-methylphenyl)carbamoyl-pentylamino]methyl]-1,3-thiazole-4-carboxylate.
| Compound Name | methyl 2-[[(2-methylphenyl)carbamoyl-pentylamino]methyl]-1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 42766922 |
| Molecular Formula | C19H25N3O3S |
| Molecular Weight | 375.49 g/mol |
| Exact Mass | 375.16 |
| IUPAC Name | methyl 2-[[(2-methylphenyl)carbamoyl-pentylamino]methyl]-1,3-thiazole-4-carboxylate |
| SMILES | CCCCCN(Cc1nc(C(=O)OC)cs1)C(=O)Nc1ccccc1C |
| InChI | InChI=1S/C19H25N3O3S/c1-4-5-8-11-22(12-17-20-16(13-26-17)18(23)25-3)19(24)21-15-10-7-6-9-14(15)2/h6-7,9-10,13H,4-5,8,11-12H2,1-3H3,(H,21,24) |
| InChIKey | DVMIEXBKZQHUGI-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.49 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|