C20H24F3N3O3S — CID 3897626
ethyl 2-[[pentyl-[[2-(trifluoromethyl)phenyl]carbamoyl]amino]methyl]-1,3-thiazole-4-carboxylate (PubChem CID 3897626) has the molecular formula C20H24F3N3O3S and a molecular weight of 443.49 g/mol. Its IUPAC name is ethyl 2-[[pentyl-[[2-(trifluoromethyl)phenyl]carbamoyl]amino]methyl]-1,3-thiazole-4-carboxylate.
| Compound Name | ethyl 2-[[pentyl-[[2-(trifluoromethyl)phenyl]carbamoyl]amino]methyl]-1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 3897626 |
| Molecular Formula | C20H24F3N3O3S |
| Molecular Weight | 443.49 g/mol |
| Exact Mass | 443.15 |
| IUPAC Name | ethyl 2-[[pentyl-[[2-(trifluoromethyl)phenyl]carbamoyl]amino]methyl]-1,3-thiazole-4-carboxylate |
| SMILES | CCCCCN(Cc1nc(C(=O)OCC)cs1)C(=O)Nc1ccccc1C(F)(F)F |
| InChI | InChI=1S/C20H24F3N3O3S/c1-3-5-8-11-26(12-17-24-16(13-30-17)18(27)29-4-2)19(28)25-15-10-7-6-9-14(15)20(21,22)23/h6-7,9-10,13H,3-5,8,11-12H2,1-2H3,(H,25,28) |
| InChIKey | KTPFPYBMFAMKGE-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.49 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|