C20H26N2O4S — CID 3652757
methyl 2-[[(4-butoxybenzoyl)-propylamino]methyl]-1,3-thiazole-4-carboxylate (PubChem CID 3652757) has the molecular formula C20H26N2O4S and a molecular weight of 390.51 g/mol. Its IUPAC name is methyl 2-[[(4-butoxybenzoyl)-propylamino]methyl]-1,3-thiazole-4-carboxylate.
| Compound Name | methyl 2-[[(4-butoxybenzoyl)-propylamino]methyl]-1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 3652757 |
| Molecular Formula | C20H26N2O4S |
| Molecular Weight | 390.51 g/mol |
| Exact Mass | 390.16 |
| IUPAC Name | methyl 2-[[(4-butoxybenzoyl)-propylamino]methyl]-1,3-thiazole-4-carboxylate |
| SMILES | CCCCOc1ccc(C(=O)N(CCC)Cc2nc(C(=O)OC)cs2)cc1 |
| InChI | InChI=1S/C20H26N2O4S/c1-4-6-12-26-16-9-7-15(8-10-16)19(23)22(11-5-2)13-18-21-17(14-27-18)20(24)25-3/h7-10,14H,4-6,11-13H2,1-3H3 |
| InChIKey | RWIAKCNUBJSTGP-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 68.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.51 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|