C21H26N2O3S — CID 3992564
methyl 2-[[cyclopropyl-(4-pentylbenzoyl)amino]methyl]-1,3-thiazole-4-carboxylate (PubChem CID 3992564) has the molecular formula C21H26N2O3S and a molecular weight of 386.52 g/mol. Its IUPAC name is methyl 2-[[cyclopropyl-(4-pentylbenzoyl)amino]methyl]-1,3-thiazole-4-carboxylate.
| Compound Name | methyl 2-[[cyclopropyl-(4-pentylbenzoyl)amino]methyl]-1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 3992564 |
| Molecular Formula | C21H26N2O3S |
| Molecular Weight | 386.52 g/mol |
| Exact Mass | 386.17 |
| IUPAC Name | methyl 2-[[cyclopropyl-(4-pentylbenzoyl)amino]methyl]-1,3-thiazole-4-carboxylate |
| SMILES | CCCCCc1ccc(C(=O)N(Cc2nc(C(=O)OC)cs2)C2CC2)cc1 |
| InChI | InChI=1S/C21H26N2O3S/c1-3-4-5-6-15-7-9-16(10-8-15)20(24)23(17-11-12-17)13-19-22-18(14-27-19)21(25)26-2/h7-10,14,17H,3-6,11-13H2,1-2H3 |
| InChIKey | XVELDCVOCRLMEZ-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.52 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|