C24H34N2O3S — CID 3400603
ethyl 2-[[tert-butyl-(4-hexylbenzoyl)amino]methyl]-1,3-thiazole-4-carboxylate (PubChem CID 3400603) has the molecular formula C24H34N2O3S and a molecular weight of 430.61 g/mol. Its IUPAC name is ethyl 2-[[tert-butyl-(4-hexylbenzoyl)amino]methyl]-1,3-thiazole-4-carboxylate.
| Compound Name | ethyl 2-[[tert-butyl-(4-hexylbenzoyl)amino]methyl]-1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 3400603 |
| Molecular Formula | C24H34N2O3S |
| Molecular Weight | 430.61 g/mol |
| Exact Mass | 430.23 |
| IUPAC Name | ethyl 2-[[tert-butyl-(4-hexylbenzoyl)amino]methyl]-1,3-thiazole-4-carboxylate |
| SMILES | CCCCCCc1ccc(C(=O)N(Cc2nc(C(=O)OCC)cs2)C(C)(C)C)cc1 |
| InChI | InChI=1S/C24H34N2O3S/c1-6-8-9-10-11-18-12-14-19(15-13-18)22(27)26(24(3,4)5)16-21-25-20(17-30-21)23(28)29-7-2/h12-15,17H,6-11,16H2,1-5H3 |
| InChIKey | JEJNVEPUGIJORB-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.61 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|