C20H25N3O5S — CID 1198422
ethyl 2-[[3-methylbutyl-(4-methyl-3-nitrobenzoyl)amino]methyl]-1,3-thiazole-4-carboxylate (PubChem CID 1198422) has the molecular formula C20H25N3O5S and a molecular weight of 419.50 g/mol. Its IUPAC name is ethyl 2-[[3-methylbutyl-(4-methyl-3-nitrobenzoyl)amino]methyl]-1,3-thiazole-4-carboxylate.
| Compound Name | ethyl 2-[[3-methylbutyl-(4-methyl-3-nitrobenzoyl)amino]methyl]-1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 1198422 |
| Molecular Formula | C20H25N3O5S |
| Molecular Weight | 419.50 g/mol |
| Exact Mass | 419.15 |
| IUPAC Name | ethyl 2-[[3-methylbutyl-(4-methyl-3-nitrobenzoyl)amino]methyl]-1,3-thiazole-4-carboxylate |
| SMILES | CCOC(=O)c1csc(CN(CCC(C)C)C(=O)c2ccc(C)c([N+](=O)[O-])c2)n1 |
| InChI | InChI=1S/C20H25N3O5S/c1-5-28-20(25)16-12-29-18(21-16)11-22(9-8-13(2)3)19(24)15-7-6-14(4)17(10-15)23(26)27/h6-7,10,12-13H,5,8-9,11H2,1-4H3 |
| InChIKey | QNAUEQHGEVJLDQ-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 102.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.50 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|