C18H28N2O3 — CID 60520289
4-methyl-N,N-bis(3-methylbutyl)-3-nitrobenzamide (PubChem CID 60520289) has the molecular formula C18H28N2O3 and a molecular weight of 320.43 g/mol. Its IUPAC name is 4-methyl-N,N-bis(3-methylbutyl)-3-nitrobenzamide.
| Compound Name | 4-methyl-N,N-bis(3-methylbutyl)-3-nitrobenzamide |
|---|---|
| PubChem CID | 60520289 |
| Molecular Formula | C18H28N2O3 |
| Molecular Weight | 320.43 g/mol |
| Exact Mass | 320.21 |
| IUPAC Name | 4-methyl-N,N-bis(3-methylbutyl)-3-nitrobenzamide |
| SMILES | Cc1ccc(C(=O)N(CCC(C)C)CCC(C)C)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C18H28N2O3/c1-13(2)8-10-19(11-9-14(3)4)18(21)16-7-6-15(5)17(12-16)20(22)23/h6-7,12-14H,8-11H2,1-5H3 |
| InChIKey | ZCYKWWPSEVUAQT-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 63.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.43 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|