C23H32N4O5 — CID 3620421
N-(3-methylbutyl)-2-[[3-methylbutyl-(4-methyl-3-nitrobenzoyl)amino]methyl]-1,3-oxazole-4-carboxamide (PubChem CID 3620421) has the molecular formula C23H32N4O5 and a molecular weight of 444.53 g/mol. Its IUPAC name is N-(3-methylbutyl)-2-[[3-methylbutyl-(4-methyl-3-nitrobenzoyl)amino]methyl]-1,3-oxazole-4-carboxamide.
| Compound Name | N-(3-methylbutyl)-2-[[3-methylbutyl-(4-methyl-3-nitrobenzoyl)amino]methyl]-1,3-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 3620421 |
| Molecular Formula | C23H32N4O5 |
| Molecular Weight | 444.53 g/mol |
| Exact Mass | 444.24 |
| IUPAC Name | N-(3-methylbutyl)-2-[[3-methylbutyl-(4-methyl-3-nitrobenzoyl)amino]methyl]-1,3-oxazole-4-carboxamide |
| SMILES | Cc1ccc(C(=O)N(CCC(C)C)Cc2nc(C(=O)NCCC(C)C)co2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C23H32N4O5/c1-15(2)8-10-24-22(28)19-14-32-21(25-19)13-26(11-9-16(3)4)23(29)18-7-6-17(5)20(12-18)27(30)31/h6-7,12,14-16H,8-11,13H2,1-5H3,(H,24,28) |
| InChIKey | OUIMOURXYAQYHU-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 118.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.53 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|