C20H25ClN4O7 — CID 42766204
2-[[(4-chloro-3-nitrobenzoyl)-(3-methoxypropyl)amino]methyl]-N-(3-methoxypropyl)-1,3-oxazole-4-carboxamide (PubChem CID 42766204) has the molecular formula C20H25ClN4O7 and a molecular weight of 468.89 g/mol. Its IUPAC name is 2-[[(4-chloro-3-nitrobenzoyl)-(3-methoxypropyl)amino]methyl]-N-(3-methoxypropyl)-1,3-oxazole-4-carboxamide.
| Compound Name | 2-[[(4-chloro-3-nitrobenzoyl)-(3-methoxypropyl)amino]methyl]-N-(3-methoxypropyl)-1,3-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 42766204 |
| Molecular Formula | C20H25ClN4O7 |
| Molecular Weight | 468.89 g/mol |
| Exact Mass | 468.14 |
| IUPAC Name | 2-[[(4-chloro-3-nitrobenzoyl)-(3-methoxypropyl)amino]methyl]-N-(3-methoxypropyl)-1,3-oxazole-4-carboxamide |
| SMILES | COCCCNC(=O)c1coc(CN(CCCOC)C(=O)c2ccc(Cl)c([N+](=O)[O-])c2)n1 |
| InChI | InChI=1S/C20H25ClN4O7/c1-30-9-3-7-22-19(26)16-13-32-18(23-16)12-24(8-4-10-31-2)20(27)14-5-6-15(21)17(11-14)25(28)29/h5-6,11,13H,3-4,7-10,12H2,1-2H3,(H,22,26) |
| InChIKey | OVDUNUGVWXZRAY-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 137.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.89 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|