C20H26FN3O5 — CID 4567958
2-[[(3-fluorobenzoyl)-(3-methoxypropyl)amino]methyl]-N-(3-methoxypropyl)-1,3-oxazole-4-carboxamide (PubChem CID 4567958) has the molecular formula C20H26FN3O5 and a molecular weight of 407.44 g/mol. Its IUPAC name is 2-[[(3-fluorobenzoyl)-(3-methoxypropyl)amino]methyl]-N-(3-methoxypropyl)-1,3-oxazole-4-carboxamide.
| Compound Name | 2-[[(3-fluorobenzoyl)-(3-methoxypropyl)amino]methyl]-N-(3-methoxypropyl)-1,3-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 4567958 |
| Molecular Formula | C20H26FN3O5 |
| Molecular Weight | 407.44 g/mol |
| Exact Mass | 407.19 |
| IUPAC Name | 2-[[(3-fluorobenzoyl)-(3-methoxypropyl)amino]methyl]-N-(3-methoxypropyl)-1,3-oxazole-4-carboxamide |
| SMILES | COCCCNC(=O)c1coc(CN(CCCOC)C(=O)c2cccc(F)c2)n1 |
| InChI | InChI=1S/C20H26FN3O5/c1-27-10-4-8-22-19(25)17-14-29-18(23-17)13-24(9-5-11-28-2)20(26)15-6-3-7-16(21)12-15/h3,6-7,12,14H,4-5,8-11,13H2,1-2H3,(H,22,25) |
| InChIKey | XVEDPTZERCSSEU-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 93.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.44 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|