C25H42N4O5 — CID 68789966
tert-butyl N-[3-[5-[bis(3-methylbutyl)carbamoyl]-2-nitroanilino]propyl]carbamate (PubChem CID 68789966) has the molecular formula C25H42N4O5 and a molecular weight of 478.63 g/mol. Its IUPAC name is tert-butyl N-[3-[5-[bis(3-methylbutyl)carbamoyl]-2-nitroanilino]propyl]carbamate.
| Compound Name | tert-butyl N-[3-[5-[bis(3-methylbutyl)carbamoyl]-2-nitroanilino]propyl]carbamate |
|---|---|
| PubChem CID | 68789966 |
| Molecular Formula | C25H42N4O5 |
| Molecular Weight | 478.63 g/mol |
| Exact Mass | 478.32 |
| IUPAC Name | tert-butyl N-[3-[5-[bis(3-methylbutyl)carbamoyl]-2-nitroanilino]propyl]carbamate |
| SMILES | CC(C)CCN(CCC(C)C)C(=O)c1ccc([N+](=O)[O-])c(NCCCNC(=O)OC(C)(C)C)c1 |
| InChI | InChI=1S/C25H42N4O5/c1-18(2)11-15-28(16-12-19(3)4)23(30)20-9-10-22(29(32)33)21(17-20)26-13-8-14-27-24(31)34-25(5,6)7/h9-10,17-19,26H,8,11-16H2,1-7H3,(H,27,31) |
| InChIKey | AOPLKQBHKMHMAK-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 113.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.63 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|