C13H18BrN3O4 — CID 66838392
tert-butyl N-[2-(5-bromo-2-nitroanilino)ethyl]carbamate (PubChem CID 66838392) has the molecular formula C13H18BrN3O4 and a molecular weight of 360.21 g/mol. Its IUPAC name is tert-butyl N-[2-(5-bromo-2-nitroanilino)ethyl]carbamate.
| Compound Name | tert-butyl N-[2-(5-bromo-2-nitroanilino)ethyl]carbamate |
|---|---|
| PubChem CID | 66838392 |
| Molecular Formula | C13H18BrN3O4 |
| Molecular Weight | 360.21 g/mol |
| Exact Mass | 359.05 |
| IUPAC Name | tert-butyl N-[2-(5-bromo-2-nitroanilino)ethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCNc1cc(Br)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C13H18BrN3O4/c1-13(2,3)21-12(18)16-7-6-15-10-8-9(14)4-5-11(10)17(19)20/h4-5,8,15H,6-7H2,1-3H3,(H,16,18) |
| InChIKey | XIVPOSPGHZNAOU-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 93.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.21 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|