C13H18N4O6 — CID 86632919
tert-butyl N-[2-(2,6-dinitroanilino)ethyl]carbamate (PubChem CID 86632919) has the molecular formula C13H18N4O6 and a molecular weight of 326.31 g/mol. Its IUPAC name is tert-butyl N-[2-(2,6-dinitroanilino)ethyl]carbamate.
| Compound Name | tert-butyl N-[2-(2,6-dinitroanilino)ethyl]carbamate |
|---|---|
| PubChem CID | 86632919 |
| Molecular Formula | C13H18N4O6 |
| Molecular Weight | 326.31 g/mol |
| Exact Mass | 326.12 |
| IUPAC Name | tert-butyl N-[2-(2,6-dinitroanilino)ethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCNc1c([N+](=O)[O-])cccc1[N+](=O)[O-] |
| InChI | InChI=1S/C13H18N4O6/c1-13(2,3)23-12(18)15-8-7-14-11-9(16(19)20)5-4-6-10(11)17(21)22/h4-6,14H,7-8H2,1-3H3,(H,15,18) |
| InChIKey | JSOZXGWKQKVNOQ-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 136.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.31 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|