C15H22N4O4S — CID 84555359
tert-butyl N-[2-[(2-methyl-3-nitrophenyl)carbamothioylamino]ethyl]carbamate (PubChem CID 84555359) has the molecular formula C15H22N4O4S and a molecular weight of 354.43 g/mol. Its IUPAC name is tert-butyl N-[2-[(2-methyl-3-nitrophenyl)carbamothioylamino]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[(2-methyl-3-nitrophenyl)carbamothioylamino]ethyl]carbamate |
|---|---|
| PubChem CID | 84555359 |
| Molecular Formula | C15H22N4O4S |
| Molecular Weight | 354.43 g/mol |
| Exact Mass | 354.14 |
| IUPAC Name | tert-butyl N-[2-[(2-methyl-3-nitrophenyl)carbamothioylamino]ethyl]carbamate |
| SMILES | Cc1c(NC(=S)NCCNC(=O)OC(C)(C)C)cccc1[N+](=O)[O-] |
| InChI | InChI=1S/C15H22N4O4S/c1-10-11(6-5-7-12(10)19(21)22)18-13(24)16-8-9-17-14(20)23-15(2,3)4/h5-7H,8-9H2,1-4H3,(H,17,20)(H2,16,18,24) |
| InChIKey | ZQGZOQAIIVIQBC-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 105.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.43 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|