C14H19ClN4O4S — CID 84551522
tert-butyl N-[2-[(2-chloro-4-nitrophenyl)carbamothioylamino]ethyl]carbamate (PubChem CID 84551522) has the molecular formula C14H19ClN4O4S and a molecular weight of 374.85 g/mol. Its IUPAC name is tert-butyl N-[2-[(2-chloro-4-nitrophenyl)carbamothioylamino]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[(2-chloro-4-nitrophenyl)carbamothioylamino]ethyl]carbamate |
|---|---|
| PubChem CID | 84551522 |
| Molecular Formula | C14H19ClN4O4S |
| Molecular Weight | 374.85 g/mol |
| Exact Mass | 374.08 |
| IUPAC Name | tert-butyl N-[2-[(2-chloro-4-nitrophenyl)carbamothioylamino]ethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCNC(=S)Nc1ccc([N+](=O)[O-])cc1Cl |
| InChI | InChI=1S/C14H19ClN4O4S/c1-14(2,3)23-13(20)17-7-6-16-12(24)18-11-5-4-9(19(21)22)8-10(11)15/h4-5,8H,6-7H2,1-3H3,(H,17,20)(H2,16,18,24) |
| InChIKey | JXQFLFRTKHRFOH-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 105.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.85 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|