C14H19F2N3O4 — CID 104933126
tert-butyl N-[2-[2-(difluoromethyl)-4-nitroanilino]ethyl]carbamate (PubChem CID 104933126) has the molecular formula C14H19F2N3O4 and a molecular weight of 331.32 g/mol. Its IUPAC name is tert-butyl N-[2-[2-(difluoromethyl)-4-nitroanilino]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[2-(difluoromethyl)-4-nitroanilino]ethyl]carbamate |
|---|---|
| PubChem CID | 104933126 |
| Molecular Formula | C14H19F2N3O4 |
| Molecular Weight | 331.32 g/mol |
| Exact Mass | 331.13 |
| IUPAC Name | tert-butyl N-[2-[2-(difluoromethyl)-4-nitroanilino]ethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCNc1ccc([N+](=O)[O-])cc1C(F)F |
| InChI | InChI=1S/C14H19F2N3O4/c1-14(2,3)23-13(20)18-7-6-17-11-5-4-9(19(21)22)8-10(11)12(15)16/h4-5,8,12,17H,6-7H2,1-3H3,(H,18,20) |
| InChIKey | NINBPROAQRSKNK-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 93.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.32 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|