C14H18F3N3O4 — CID 2795746
tert-butyl N-[2-[2-nitro-4-(trifluoromethyl)anilino]ethyl]carbamate (PubChem CID 2795746) has the molecular formula C14H18F3N3O4 and a molecular weight of 349.31 g/mol. Its IUPAC name is tert-butyl N-[2-[2-nitro-4-(trifluoromethyl)anilino]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[2-nitro-4-(trifluoromethyl)anilino]ethyl]carbamate |
|---|---|
| PubChem CID | 2795746 |
| Molecular Formula | C14H18F3N3O4 |
| Molecular Weight | 349.31 g/mol |
| Exact Mass | 349.12 |
| IUPAC Name | tert-butyl N-[2-[2-nitro-4-(trifluoromethyl)anilino]ethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCNc1ccc(C(F)(F)F)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C14H18F3N3O4/c1-13(2,3)24-12(21)19-7-6-18-10-5-4-9(14(15,16)17)8-11(10)20(22)23/h4-5,8,18H,6-7H2,1-3H3,(H,19,21) |
| InChIKey | AFKGDSDZTRMJTA-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 93.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.31 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|