C13H16F3N5O4 — CID 9277045
(2S)-2-(carbamoylamino)-N-[2-[2-nitro-4-(trifluoromethyl)anilino]ethyl]propanamide (PubChem CID 9277045) has the molecular formula C13H16F3N5O4 and a molecular weight of 363.30 g/mol. Its IUPAC name is (2S)-2-(carbamoylamino)-N-[2-[2-nitro-4-(trifluoromethyl)anilino]ethyl]propanamide.
| Compound Name | (2S)-2-(carbamoylamino)-N-[2-[2-nitro-4-(trifluoromethyl)anilino]ethyl]propanamide |
|---|---|
| PubChem CID | 9277045 |
| Molecular Formula | C13H16F3N5O4 |
| Molecular Weight | 363.30 g/mol |
| Exact Mass | 363.12 |
| IUPAC Name | (2S)-2-(carbamoylamino)-N-[2-[2-nitro-4-(trifluoromethyl)anilino]ethyl]propanamide |
| SMILES | C[C@H](NC(N)=O)C(=O)NCCNc1ccc(C(F)(F)F)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C13H16F3N5O4/c1-7(20-12(17)23)11(22)19-5-4-18-9-3-2-8(13(14,15)16)6-10(9)21(24)25/h2-3,6-7,18H,4-5H2,1H3,(H,19,22)(H3,17,20,23)/t7-/m0/s1 |
| InChIKey | BNIIHCFNTOUFOJ-ZETCQYMHSA-N |
| XLogP | 1.20 |
| TPSA | 139.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.30 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|