C14H19F3N4O3 — CID 119627954
N-(2-amino-2-methylpropyl)-3-[2-nitro-4-(trifluoromethyl)anilino]propanamide (PubChem CID 119627954) has the molecular formula C14H19F3N4O3 and a molecular weight of 348.33 g/mol. Its IUPAC name is N-(2-amino-2-methylpropyl)-3-[2-nitro-4-(trifluoromethyl)anilino]propanamide.
| Compound Name | N-(2-amino-2-methylpropyl)-3-[2-nitro-4-(trifluoromethyl)anilino]propanamide |
|---|---|
| PubChem CID | 119627954 |
| Molecular Formula | C14H19F3N4O3 |
| Molecular Weight | 348.33 g/mol |
| Exact Mass | 348.14 |
| IUPAC Name | N-(2-amino-2-methylpropyl)-3-[2-nitro-4-(trifluoromethyl)anilino]propanamide |
| SMILES | CC(C)(N)CNC(=O)CCNc1ccc(C(F)(F)F)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C14H19F3N4O3/c1-13(2,18)8-20-12(22)5-6-19-10-4-3-9(14(15,16)17)7-11(10)21(23)24/h3-4,7,19H,5-6,8,18H2,1-2H3,(H,20,22) |
| InChIKey | MZGKFQHJYIPYSK-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 110.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.33 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|