C20H20F3N5O5 — CID 46494654
N-(2-amino-2-oxoethyl)-4-[[3-[2-nitro-4-(trifluoromethyl)anilino]propanoylamino]methyl]benzamide (PubChem CID 46494654) has the molecular formula C20H20F3N5O5 and a molecular weight of 467.40 g/mol. Its IUPAC name is N-(2-amino-2-oxoethyl)-4-[[3-[2-nitro-4-(trifluoromethyl)anilino]propanoylamino]methyl]benzamide.
| Compound Name | N-(2-amino-2-oxoethyl)-4-[[3-[2-nitro-4-(trifluoromethyl)anilino]propanoylamino]methyl]benzamide |
|---|---|
| PubChem CID | 46494654 |
| Molecular Formula | C20H20F3N5O5 |
| Molecular Weight | 467.40 g/mol |
| Exact Mass | 467.14 |
| IUPAC Name | N-(2-amino-2-oxoethyl)-4-[[3-[2-nitro-4-(trifluoromethyl)anilino]propanoylamino]methyl]benzamide |
| SMILES | NC(=O)CNC(=O)c1ccc(CNC(=O)CCNc2ccc(C(F)(F)F)cc2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C20H20F3N5O5/c21-20(22,23)14-5-6-15(16(9-14)28(32)33)25-8-7-18(30)26-10-12-1-3-13(4-2-12)19(31)27-11-17(24)29/h1-6,9,25H,7-8,10-11H2,(H2,24,29)(H,26,30)(H,27,31) |
| InChIKey | RBUVCFLQCJQQCI-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 156.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.40 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|