C23H21F3N4O4 — CID 46476014
3-[2-nitro-4-(trifluoromethyl)anilino]-N-[[4-(pyridin-3-ylmethoxy)phenyl]methyl]propanamide (PubChem CID 46476014) has the molecular formula C23H21F3N4O4 and a molecular weight of 474.44 g/mol. Its IUPAC name is 3-[2-nitro-4-(trifluoromethyl)anilino]-N-[[4-(pyridin-3-ylmethoxy)phenyl]methyl]propanamide.
| Compound Name | 3-[2-nitro-4-(trifluoromethyl)anilino]-N-[[4-(pyridin-3-ylmethoxy)phenyl]methyl]propanamide |
|---|---|
| PubChem CID | 46476014 |
| Molecular Formula | C23H21F3N4O4 |
| Molecular Weight | 474.44 g/mol |
| Exact Mass | 474.15 |
| IUPAC Name | 3-[2-nitro-4-(trifluoromethyl)anilino]-N-[[4-(pyridin-3-ylmethoxy)phenyl]methyl]propanamide |
| SMILES | O=C(CCNc1ccc(C(F)(F)F)cc1[N+](=O)[O-])NCc1ccc(OCc2cccnc2)cc1 |
| InChI | InChI=1S/C23H21F3N4O4/c24-23(25,26)18-5-8-20(21(12-18)30(32)33)28-11-9-22(31)29-14-16-3-6-19(7-4-16)34-15-17-2-1-10-27-13-17/h1-8,10,12-13,28H,9,11,14-15H2,(H,29,31) |
| InChIKey | LPUGFEOEMRZKHT-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 106.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.44 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|