C15H19F3N4O4 — CID 60557990
2,2-dimethyl-3-[3-[2-nitro-4-(trifluoromethyl)anilino]propanoylamino]propanamide (PubChem CID 60557990) has the molecular formula C15H19F3N4O4 and a molecular weight of 376.34 g/mol. Its IUPAC name is 2,2-dimethyl-3-[3-[2-nitro-4-(trifluoromethyl)anilino]propanoylamino]propanamide.
| Compound Name | 2,2-dimethyl-3-[3-[2-nitro-4-(trifluoromethyl)anilino]propanoylamino]propanamide |
|---|---|
| PubChem CID | 60557990 |
| Molecular Formula | C15H19F3N4O4 |
| Molecular Weight | 376.34 g/mol |
| Exact Mass | 376.14 |
| IUPAC Name | 2,2-dimethyl-3-[3-[2-nitro-4-(trifluoromethyl)anilino]propanoylamino]propanamide |
| SMILES | CC(C)(CNC(=O)CCNc1ccc(C(F)(F)F)cc1[N+](=O)[O-])C(N)=O |
| InChI | InChI=1S/C15H19F3N4O4/c1-14(2,13(19)24)8-21-12(23)5-6-20-10-4-3-9(15(16,17)18)7-11(10)22(25)26/h3-4,7,20H,5-6,8H2,1-2H3,(H2,19,24)(H,21,23) |
| InChIKey | RSRHFQRRHMBZQY-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 127.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.34 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|