C18H17F4N3O4 — CID 78866833
N-[2-(4-fluorophenyl)-2-hydroxyethyl]-3-[2-nitro-4-(trifluoromethyl)anilino]propanamide (PubChem CID 78866833) has the molecular formula C18H17F4N3O4 and a molecular weight of 415.34 g/mol. Its IUPAC name is N-[2-(4-fluorophenyl)-2-hydroxyethyl]-3-[2-nitro-4-(trifluoromethyl)anilino]propanamide.
| Compound Name | N-[2-(4-fluorophenyl)-2-hydroxyethyl]-3-[2-nitro-4-(trifluoromethyl)anilino]propanamide |
|---|---|
| PubChem CID | 78866833 |
| Molecular Formula | C18H17F4N3O4 |
| Molecular Weight | 415.34 g/mol |
| Exact Mass | 415.12 |
| IUPAC Name | N-[2-(4-fluorophenyl)-2-hydroxyethyl]-3-[2-nitro-4-(trifluoromethyl)anilino]propanamide |
| SMILES | O=C(CCNc1ccc(C(F)(F)F)cc1[N+](=O)[O-])NCC(O)c1ccc(F)cc1 |
| InChI | InChI=1S/C18H17F4N3O4/c19-13-4-1-11(2-5-13)16(26)10-24-17(27)7-8-23-14-6-3-12(18(20,21)22)9-15(14)25(28)29/h1-6,9,16,23,26H,7-8,10H2,(H,24,27) |
| InChIKey | CPBWXPQYCWYLNV-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 104.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.34 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|