C18H13F5N4O3 — CID 56584340
N-[cyano-(2,4-difluorophenyl)methyl]-3-[2-nitro-4-(trifluoromethyl)anilino]propanamide (PubChem CID 56584340) has the molecular formula C18H13F5N4O3 and a molecular weight of 428.32 g/mol. Its IUPAC name is N-[cyano-(2,4-difluorophenyl)methyl]-3-[2-nitro-4-(trifluoromethyl)anilino]propanamide.
| Compound Name | N-[cyano-(2,4-difluorophenyl)methyl]-3-[2-nitro-4-(trifluoromethyl)anilino]propanamide |
|---|---|
| PubChem CID | 56584340 |
| Molecular Formula | C18H13F5N4O3 |
| Molecular Weight | 428.32 g/mol |
| Exact Mass | 428.09 |
| IUPAC Name | N-[cyano-(2,4-difluorophenyl)methyl]-3-[2-nitro-4-(trifluoromethyl)anilino]propanamide |
| SMILES | N#CC(NC(=O)CCNc1ccc(C(F)(F)F)cc1[N+](=O)[O-])c1ccc(F)cc1F |
| InChI | InChI=1S/C18H13F5N4O3/c19-11-2-3-12(13(20)8-11)15(9-24)26-17(28)5-6-25-14-4-1-10(18(21,22)23)7-16(14)27(29)30/h1-4,7-8,15,25H,5-6H2,(H,26,28) |
| InChIKey | NCUKYVVYVDGWAM-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 108.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.32 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|