C15H20ClF3N4O3 — CID 119615025
N-(2-amino-1-cyclopropylethyl)-3-[2-nitro-4-(trifluoromethyl)anilino]propanamide;hydrochloride (PubChem CID 119615025) has the molecular formula C15H20ClF3N4O3 and a molecular weight of 396.80 g/mol. Its IUPAC name is N-(2-amino-1-cyclopropylethyl)-3-[2-nitro-4-(trifluoromethyl)anilino]propanamide;hydrochloride.
| Compound Name | N-(2-amino-1-cyclopropylethyl)-3-[2-nitro-4-(trifluoromethyl)anilino]propanamide;hydrochloride |
|---|---|
| PubChem CID | 119615025 |
| Molecular Formula | C15H20ClF3N4O3 |
| Molecular Weight | 396.80 g/mol |
| Exact Mass | 396.12 |
| IUPAC Name | N-(2-amino-1-cyclopropylethyl)-3-[2-nitro-4-(trifluoromethyl)anilino]propanamide;hydrochloride |
| SMILES | Cl.NCC(NC(=O)CCNc1ccc(C(F)(F)F)cc1[N+](=O)[O-])C1CC1 |
| InChI | InChI=1S/C15H19F3N4O3.ClH/c16-15(17,18)10-3-4-11(13(7-10)22(24)25)20-6-5-14(23)21-12(8-19)9-1-2-9;/h3-4,7,9,12,20H,1-2,5-6,8,19H2,(H,21,23);1H |
| InChIKey | XELKCLLDMZNNAC-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 110.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.80 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|