C16H19F3N4O4 — CID 96510518
trans-(1S,2S)-2-[3-[2-nitro-4-(trifluoromethyl)anilino]propanoylamino]cyclopentane-1-carboxamide (PubChem CID 96510518) has the molecular formula C16H19F3N4O4 and a molecular weight of 388.35 g/mol. Its IUPAC name is trans-(1S,2S)-2-[3-[2-nitro-4-(trifluoromethyl)anilino]propanoylamino]cyclopentane-1-carboxamide.
| Compound Name | trans-(1S,2S)-2-[3-[2-nitro-4-(trifluoromethyl)anilino]propanoylamino]cyclopentane-1-carboxamide |
|---|---|
| PubChem CID | 96510518 |
| Molecular Formula | C16H19F3N4O4 |
| Molecular Weight | 388.35 g/mol |
| Exact Mass | 388.14 |
| IUPAC Name | trans-(1S,2S)-2-[3-[2-nitro-4-(trifluoromethyl)anilino]propanoylamino]cyclopentane-1-carboxamide |
| SMILES | NC(=O)[C@H]1CCC[C@@H]1NC(=O)CCNc1ccc(C(F)(F)F)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C16H19F3N4O4/c17-16(18,19)9-4-5-12(13(8-9)23(26)27)21-7-6-14(24)22-11-3-1-2-10(11)15(20)25/h4-5,8,10-11,21H,1-3,6-7H2,(H2,20,25)(H,22,24)/t10-,11-/m0/s1 |
| InChIKey | SSIUTVQAGVEFTC-QWRGUYRKSA-N |
| XLogP | 2.19 |
| TPSA | 127.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.35 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|