C16H20F3N3O3 — CID 99776123
N-[(1S,2R)-2-(aminomethyl)cyclohexyl]-2-[2-nitro-4-(trifluoromethyl)phenyl]acetamide (PubChem CID 99776123) has the molecular formula C16H20F3N3O3 and a molecular weight of 359.35 g/mol. Its IUPAC name is N-[(1S,2R)-2-(aminomethyl)cyclohexyl]-2-[2-nitro-4-(trifluoromethyl)phenyl]acetamide.
| Compound Name | N-[(1S,2R)-2-(aminomethyl)cyclohexyl]-2-[2-nitro-4-(trifluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 99776123 |
| Molecular Formula | C16H20F3N3O3 |
| Molecular Weight | 359.35 g/mol |
| Exact Mass | 359.15 |
| IUPAC Name | N-[(1S,2R)-2-(aminomethyl)cyclohexyl]-2-[2-nitro-4-(trifluoromethyl)phenyl]acetamide |
| SMILES | NC[C@H]1CCCC[C@@H]1NC(=O)Cc1ccc(C(F)(F)F)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C16H20F3N3O3/c17-16(18,19)12-6-5-10(14(8-12)22(24)25)7-15(23)21-13-4-2-1-3-11(13)9-20/h5-6,8,11,13H,1-4,7,9,20H2,(H,21,23)/t11-,13+/m1/s1 |
| InChIKey | GYPUTTODMIKSDW-YPMHNXCESA-N |
| XLogP | 2.79 |
| TPSA | 98.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.35 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|