C13H15F3N2O3 — CID 22100123
2-[2-nitro-4-(trifluoromethyl)anilino]cyclohexan-1-ol (PubChem CID 22100123) has the molecular formula C13H15F3N2O3 and a molecular weight of 304.27 g/mol. Its IUPAC name is 2-[2-nitro-4-(trifluoromethyl)anilino]cyclohexan-1-ol.
| Compound Name | 2-[2-nitro-4-(trifluoromethyl)anilino]cyclohexan-1-ol |
|---|---|
| PubChem CID | 22100123 |
| Molecular Formula | C13H15F3N2O3 |
| Molecular Weight | 304.27 g/mol |
| Exact Mass | 304.10 |
| IUPAC Name | 2-[2-nitro-4-(trifluoromethyl)anilino]cyclohexan-1-ol |
| SMILES | O=[N+]([O-])c1cc(C(F)(F)F)ccc1NC1CCCCC1O |
| InChI | InChI=1S/C13H15F3N2O3/c14-13(15,16)8-5-6-9(11(7-8)18(20)21)17-10-3-1-2-4-12(10)19/h5-7,10,12,17,19H,1-4H2 |
| InChIKey | GXCRZRZENXLSNT-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 75.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.27 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|