C14H17F3N2OS — CID 62361318
2-[(2-hydroxycyclohexyl)amino]-5-(trifluoromethyl)benzenecarbothioamide (PubChem CID 62361318) has the molecular formula C14H17F3N2OS and a molecular weight of 318.36 g/mol. Its IUPAC name is 2-[(2-hydroxycyclohexyl)amino]-5-(trifluoromethyl)benzenecarbothioamide.
| Compound Name | 2-[(2-hydroxycyclohexyl)amino]-5-(trifluoromethyl)benzenecarbothioamide |
|---|---|
| PubChem CID | 62361318 |
| Molecular Formula | C14H17F3N2OS |
| Molecular Weight | 318.36 g/mol |
| Exact Mass | 318.10 |
| IUPAC Name | 2-[(2-hydroxycyclohexyl)amino]-5-(trifluoromethyl)benzenecarbothioamide |
| SMILES | NC(=S)c1cc(C(F)(F)F)ccc1NC1CCCCC1O |
| InChI | InChI=1S/C14H17F3N2OS/c15-14(16,17)8-5-6-10(9(7-8)13(18)21)19-11-3-1-2-4-12(11)20/h5-7,11-12,19-20H,1-4H2,(H2,18,21) |
| InChIKey | GAAYTMQYVCQGNH-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.36 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|