C15H19F3N2S — CID 114546691
2-[(3,3-dimethylcyclopentyl)amino]-5-(trifluoromethyl)benzenecarbothioamide (PubChem CID 114546691) has the molecular formula C15H19F3N2S and a molecular weight of 316.39 g/mol. Its IUPAC name is 2-[(3,3-dimethylcyclopentyl)amino]-5-(trifluoromethyl)benzenecarbothioamide.
| Compound Name | 2-[(3,3-dimethylcyclopentyl)amino]-5-(trifluoromethyl)benzenecarbothioamide |
|---|---|
| PubChem CID | 114546691 |
| Molecular Formula | C15H19F3N2S |
| Molecular Weight | 316.39 g/mol |
| Exact Mass | 316.12 |
| IUPAC Name | 2-[(3,3-dimethylcyclopentyl)amino]-5-(trifluoromethyl)benzenecarbothioamide |
| SMILES | CC1(C)CCC(Nc2ccc(C(F)(F)F)cc2C(N)=S)C1 |
| InChI | InChI=1S/C15H19F3N2S/c1-14(2)6-5-10(8-14)20-12-4-3-9(15(16,17)18)7-11(12)13(19)21/h3-4,7,10,20H,5-6,8H2,1-2H3,(H2,19,21) |
| InChIKey | HTHTWOQGBHPVPL-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.39 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|