C15H21BrN2S — CID 114891973
5-bromo-2-[(3,3-dimethylcyclohexyl)amino]benzenecarbothioamide (PubChem CID 114891973) has the molecular formula C15H21BrN2S and a molecular weight of 341.32 g/mol. Its IUPAC name is 5-bromo-2-[(3,3-dimethylcyclohexyl)amino]benzenecarbothioamide.
| Compound Name | 5-bromo-2-[(3,3-dimethylcyclohexyl)amino]benzenecarbothioamide |
|---|---|
| PubChem CID | 114891973 |
| Molecular Formula | C15H21BrN2S |
| Molecular Weight | 341.32 g/mol |
| Exact Mass | 340.06 |
| IUPAC Name | 5-bromo-2-[(3,3-dimethylcyclohexyl)amino]benzenecarbothioamide |
| SMILES | CC1(C)CCCC(Nc2ccc(Br)cc2C(N)=S)C1 |
| InChI | InChI=1S/C15H21BrN2S/c1-15(2)7-3-4-11(9-15)18-13-6-5-10(16)8-12(13)14(17)19/h5-6,8,11,18H,3-4,7,9H2,1-2H3,(H2,17,19) |
| InChIKey | ZKZWAKNRNOOZQO-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.32 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|