C15H20BrNOS — CID 114892302
5-bromo-2-(4,4-dimethylcyclohexyl)oxybenzenecarbothioamide (PubChem CID 114892302) has the molecular formula C15H20BrNOS and a molecular weight of 342.30 g/mol. Its IUPAC name is 5-bromo-2-(4,4-dimethylcyclohexyl)oxybenzenecarbothioamide.
| Compound Name | 5-bromo-2-(4,4-dimethylcyclohexyl)oxybenzenecarbothioamide |
|---|---|
| PubChem CID | 114892302 |
| Molecular Formula | C15H20BrNOS |
| Molecular Weight | 342.30 g/mol |
| Exact Mass | 341.04 |
| IUPAC Name | 5-bromo-2-(4,4-dimethylcyclohexyl)oxybenzenecarbothioamide |
| SMILES | CC1(C)CCC(Oc2ccc(Br)cc2C(N)=S)CC1 |
| InChI | InChI=1S/C15H20BrNOS/c1-15(2)7-5-11(6-8-15)18-13-4-3-10(16)9-12(13)14(17)19/h3-4,9,11H,5-8H2,1-2H3,(H2,17,19) |
| InChIKey | POEJSXJEQRLRJP-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.30 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|