C17H25NOS — CID 107929541
5-methyl-2-(3,3,5-trimethylcyclohexyl)oxybenzenecarbothioamide (PubChem CID 107929541) has the molecular formula C17H25NOS and a molecular weight of 291.46 g/mol. Its IUPAC name is 5-methyl-2-(3,3,5-trimethylcyclohexyl)oxybenzenecarbothioamide.
| Compound Name | 5-methyl-2-(3,3,5-trimethylcyclohexyl)oxybenzenecarbothioamide |
|---|---|
| PubChem CID | 107929541 |
| Molecular Formula | C17H25NOS |
| Molecular Weight | 291.46 g/mol |
| Exact Mass | 291.17 |
| IUPAC Name | 5-methyl-2-(3,3,5-trimethylcyclohexyl)oxybenzenecarbothioamide |
| SMILES | Cc1ccc(OC2CC(C)CC(C)(C)C2)c(C(N)=S)c1 |
| InChI | InChI=1S/C17H25NOS/c1-11-5-6-15(14(8-11)16(18)20)19-13-7-12(2)9-17(3,4)10-13/h5-6,8,12-13H,7,9-10H2,1-4H3,(H2,18,20) |
| InChIKey | BHIVQSQADVETOG-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.46 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|