C17H23BrO2 — CID 82971519
1-[5-bromo-2-(3,3,5-trimethylcyclohexyl)oxyphenyl]ethanone (PubChem CID 82971519) has the molecular formula C17H23BrO2 and a molecular weight of 339.27 g/mol. Its IUPAC name is 1-[5-bromo-2-(3,3,5-trimethylcyclohexyl)oxyphenyl]ethanone.
| Compound Name | 1-[5-bromo-2-(3,3,5-trimethylcyclohexyl)oxyphenyl]ethanone |
|---|---|
| PubChem CID | 82971519 |
| Molecular Formula | C17H23BrO2 |
| Molecular Weight | 339.27 g/mol |
| Exact Mass | 338.09 |
| IUPAC Name | 1-[5-bromo-2-(3,3,5-trimethylcyclohexyl)oxyphenyl]ethanone |
| SMILES | CC(=O)c1cc(Br)ccc1OC1CC(C)CC(C)(C)C1 |
| InChI | InChI=1S/C17H23BrO2/c1-11-7-14(10-17(3,4)9-11)20-16-6-5-13(18)8-15(16)12(2)19/h5-6,8,11,14H,7,9-10H2,1-4H3 |
| InChIKey | DRJCUQZLPLBCQW-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.27 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |