C16H22BrNOS — CID 114903690
4-bromo-2-(3,3,5-trimethylcyclohexyl)oxybenzenecarbothioamide (PubChem CID 114903690) has the molecular formula C16H22BrNOS and a molecular weight of 356.33 g/mol. Its IUPAC name is 4-bromo-2-(3,3,5-trimethylcyclohexyl)oxybenzenecarbothioamide.
| Compound Name | 4-bromo-2-(3,3,5-trimethylcyclohexyl)oxybenzenecarbothioamide |
|---|---|
| PubChem CID | 114903690 |
| Molecular Formula | C16H22BrNOS |
| Molecular Weight | 356.33 g/mol |
| Exact Mass | 355.06 |
| IUPAC Name | 4-bromo-2-(3,3,5-trimethylcyclohexyl)oxybenzenecarbothioamide |
| SMILES | CC1CC(Oc2cc(Br)ccc2C(N)=S)CC(C)(C)C1 |
| InChI | InChI=1S/C16H22BrNOS/c1-10-6-12(9-16(2,3)8-10)19-14-7-11(17)4-5-13(14)15(18)20/h4-5,7,10,12H,6,8-9H2,1-3H3,(H2,18,20) |
| InChIKey | LYHASULEVQTFJH-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.33 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|