C16H21ClO3 — CID 63514188
3-chloro-4-(3,3,5-trimethylcyclohexyl)oxybenzoic acid (PubChem CID 63514188) has the molecular formula C16H21ClO3 and a molecular weight of 296.79 g/mol. Its IUPAC name is 3-chloro-4-(3,3,5-trimethylcyclohexyl)oxybenzoic acid.
| Compound Name | 3-chloro-4-(3,3,5-trimethylcyclohexyl)oxybenzoic acid |
|---|---|
| PubChem CID | 63514188 |
| Molecular Formula | C16H21ClO3 |
| Molecular Weight | 296.79 g/mol |
| Exact Mass | 296.12 |
| IUPAC Name | 3-chloro-4-(3,3,5-trimethylcyclohexyl)oxybenzoic acid |
| SMILES | CC1CC(Oc2ccc(C(=O)O)cc2Cl)CC(C)(C)C1 |
| InChI | InChI=1S/C16H21ClO3/c1-10-6-12(9-16(2,3)8-10)20-14-5-4-11(15(18)19)7-13(14)17/h4-5,7,10,12H,6,8-9H2,1-3H3,(H,18,19) |
| InChIKey | JXXQAQLFVWNPDA-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.79 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |