C16H23ClN2O2 — CID 76997828
3-chloro-N'-hydroxy-4-(3,3,5-trimethylcyclohexyl)oxybenzenecarboximidamide (PubChem CID 76997828) has the molecular formula C16H23ClN2O2 and a molecular weight of 310.83 g/mol. Its IUPAC name is 3-chloro-N'-hydroxy-4-(3,3,5-trimethylcyclohexyl)oxybenzenecarboximidamide.
| Compound Name | 3-chloro-N'-hydroxy-4-(3,3,5-trimethylcyclohexyl)oxybenzenecarboximidamide |
|---|---|
| PubChem CID | 76997828 |
| Molecular Formula | C16H23ClN2O2 |
| Molecular Weight | 310.83 g/mol |
| Exact Mass | 310.14 |
| IUPAC Name | 3-chloro-N'-hydroxy-4-(3,3,5-trimethylcyclohexyl)oxybenzenecarboximidamide |
| SMILES | CC1CC(Oc2ccc(C(N)=NO)cc2Cl)CC(C)(C)C1 |
| InChI | InChI=1S/C16H23ClN2O2/c1-10-6-12(9-16(2,3)8-10)21-14-5-4-11(7-13(14)17)15(18)19-20/h4-5,7,10,12,20H,6,8-9H2,1-3H3,(H2,18,19) |
| InChIKey | JXUUZQJZUHFWNK-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 67.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.83 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|