C17H26N2O2 — CID 107109717
N'-hydroxy-3-methyl-2-(3,3,5-trimethylcyclohexyl)oxybenzenecarboximidamide (PubChem CID 107109717) has the molecular formula C17H26N2O2 and a molecular weight of 290.41 g/mol. Its IUPAC name is N'-hydroxy-3-methyl-2-(3,3,5-trimethylcyclohexyl)oxybenzenecarboximidamide.
| Compound Name | N'-hydroxy-3-methyl-2-(3,3,5-trimethylcyclohexyl)oxybenzenecarboximidamide |
|---|---|
| PubChem CID | 107109717 |
| Molecular Formula | C17H26N2O2 |
| Molecular Weight | 290.41 g/mol |
| Exact Mass | 290.20 |
| IUPAC Name | N'-hydroxy-3-methyl-2-(3,3,5-trimethylcyclohexyl)oxybenzenecarboximidamide |
| SMILES | Cc1cccc(/C(N)=N/O)c1OC1CC(C)CC(C)(C)C1 |
| InChI | InChI=1S/C17H26N2O2/c1-11-8-13(10-17(3,4)9-11)21-15-12(2)6-5-7-14(15)16(18)19-20/h5-7,11,13,20H,8-10H2,1-4H3,(H2,18,19) |
| InChIKey | LPVIJNDOJBDVQK-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 67.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.41 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|