C9H12N2O2 — CID 88561585
N'-hydroxy-2-methoxy-3-methylbenzenecarboximidamide (PubChem CID 88561585) has the molecular formula C9H12N2O2 and a molecular weight of 180.21 g/mol. Its IUPAC name is N'-hydroxy-2-methoxy-3-methylbenzenecarboximidamide.
| Compound Name | N'-hydroxy-2-methoxy-3-methylbenzenecarboximidamide |
|---|---|
| PubChem CID | 88561585 |
| Molecular Formula | C9H12N2O2 |
| Molecular Weight | 180.21 g/mol |
| Exact Mass | 180.09 |
| IUPAC Name | N'-hydroxy-2-methoxy-3-methylbenzenecarboximidamide |
| SMILES | COc1c(C)cccc1/C(N)=N/O |
| InChI | InChI=1S/C9H12N2O2/c1-6-4-3-5-7(8(6)13-2)9(10)11-12/h3-5,12H,1-2H3,(H2,10,11) |
| InChIKey | OWMVSNYJHPYZAH-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 67.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.21 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|