C15H16N2O4 — CID 43200034
2-(2,6-dimethoxyphenoxy)-N'-hydroxybenzenecarboximidamide (PubChem CID 43200034) has the molecular formula C15H16N2O4 and a molecular weight of 288.30 g/mol. Its IUPAC name is 2-(2,6-dimethoxyphenoxy)-N'-hydroxybenzenecarboximidamide.
| Compound Name | 2-(2,6-dimethoxyphenoxy)-N'-hydroxybenzenecarboximidamide |
|---|---|
| PubChem CID | 43200034 |
| Molecular Formula | C15H16N2O4 |
| Molecular Weight | 288.30 g/mol |
| Exact Mass | 288.11 |
| IUPAC Name | 2-(2,6-dimethoxyphenoxy)-N'-hydroxybenzenecarboximidamide |
| SMILES | COc1cccc(OC)c1Oc1ccccc1/C(N)=N/O |
| InChI | InChI=1S/C15H16N2O4/c1-19-12-8-5-9-13(20-2)14(12)21-11-7-4-3-6-10(11)15(16)17-18/h3-9,18H,1-2H3,(H2,16,17) |
| InChIKey | QGLORNHVNXDBQF-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 86.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.30 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|