About 4-chloro-2-[(3,3-dimethylcyclopentyl)amino]benzenecarbothioamide
4-chloro-2-[(3,3-dimethylcyclopentyl)amino]benzenecarbothioamide (PubChem CID 114546702) has the molecular formula C14H19ClN2S
and a molecular weight of 282.84 g/mol. Its IUPAC name is 4-chloro-2-[(3,3-dimethylcyclopentyl)amino]benzenecarbothioamide.
Molecular Properties
| Compound Name | 4-chloro-2-[(3,3-dimethylcyclopentyl)amino]benzenecarbothioamide |
| PubChem CID | 114546702 |
| Molecular Formula | C14H19ClN2S |
| Molecular Weight | 282.84 g/mol |
| Exact Mass | 282.10 |
| IUPAC Name | 4-chloro-2-[(3,3-dimethylcyclopentyl)amino]benzenecarbothioamide |
| SMILES | CC1(C)CCC(Nc2cc(Cl)ccc2C(N)=S)C1 |
| InChI | InChI=1S/C14H19ClN2S/c1-14(2)6-5-10(8-14)17-12-7-9(15)3-4-11(12)13(16)18/h3-4,7,10,17H,5-6,8H2,1-2H3,(H2,16,18) |
| InChIKey | ZHQGFIDSKQVUGX-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.84 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 4-chloro-2-[(3,3-dimethylcyclopentyl)amino]benzenecarbothioamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-2-[(3,3-dimethylcyclopentyl)amino]benzenecarbothioamide?
The IUPAC name of 4-chloro-2-[(3,3-dimethylcyclopentyl)amino]benzenecarbothioamide (CID 114546702) is 4-chloro-2-[(3,3-dimethylcyclopentyl)amino]benzenecarbothioamide.
What is the SMILES notation for 4-chloro-2-[(3,3-dimethylcyclopentyl)amino]benzenecarbothioamide?
The canonical SMILES for 4-chloro-2-[(3,3-dimethylcyclopentyl)amino]benzenecarbothioamide is CC1(C)CCC(Nc2cc(Cl)ccc2C(N)=S)C1.
What is the InChIKey of 4-chloro-2-[(3,3-dimethylcyclopentyl)amino]benzenecarbothioamide?
The InChIKey is ZHQGFIDSKQVUGX-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19ClN2S/c1-14(2)6-5-10(8-14)17-12-7-9(15)3-4-11(12)13(16)18/h3-4,7,10,17H,5-6,8H2,1-2H3,(H2,16,18).
What are the key properties of 4-chloro-2-[(3,3-dimethylcyclopentyl)amino]benzenecarbothioamide?
4-chloro-2-[(3,3-dimethylcyclopentyl)amino]benzenecarbothioamide has a molecular weight of 282.84 g/mol, XLogP of 3.96, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-2-[(3,3-dimethylcyclopentyl)amino]benzenecarbothioamide is sourced from PubChem (CID 114546702), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).