C16H23ClN2OS — CID 83036686
4-chloro-2-[(2,2-diethyloxan-4-yl)amino]benzenecarbothioamide (PubChem CID 83036686) has the molecular formula C16H23ClN2OS and a molecular weight of 326.89 g/mol. Its IUPAC name is 4-chloro-2-[(2,2-diethyloxan-4-yl)amino]benzenecarbothioamide.
| Compound Name | 4-chloro-2-[(2,2-diethyloxan-4-yl)amino]benzenecarbothioamide |
|---|---|
| PubChem CID | 83036686 |
| Molecular Formula | C16H23ClN2OS |
| Molecular Weight | 326.89 g/mol |
| Exact Mass | 326.12 |
| IUPAC Name | 4-chloro-2-[(2,2-diethyloxan-4-yl)amino]benzenecarbothioamide |
| SMILES | CCC1(CC)CC(Nc2cc(Cl)ccc2C(N)=S)CCO1 |
| InChI | InChI=1S/C16H23ClN2OS/c1-3-16(4-2)10-12(7-8-20-16)19-14-9-11(17)5-6-13(14)15(18)21/h5-6,9,12,19H,3-4,7-8,10H2,1-2H3,(H2,18,21) |
| InChIKey | MNBZRZYEGAUVNM-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.89 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|