C13H19Cl2N3O — CID 83028580
3,6-dichloro-N-(2,2-diethyloxan-4-yl)pyridazin-4-amine (PubChem CID 83028580) has the molecular formula C13H19Cl2N3O and a molecular weight of 304.22 g/mol. Its IUPAC name is 3,6-dichloro-N-(2,2-diethyloxan-4-yl)pyridazin-4-amine.
| Compound Name | 3,6-dichloro-N-(2,2-diethyloxan-4-yl)pyridazin-4-amine |
|---|---|
| PubChem CID | 83028580 |
| Molecular Formula | C13H19Cl2N3O |
| Molecular Weight | 304.22 g/mol |
| Exact Mass | 303.09 |
| IUPAC Name | 3,6-dichloro-N-(2,2-diethyloxan-4-yl)pyridazin-4-amine |
| SMILES | CCC1(CC)CC(Nc2cc(Cl)nnc2Cl)CCO1 |
| InChI | InChI=1S/C13H19Cl2N3O/c1-3-13(4-2)8-9(5-6-19-13)16-10-7-11(14)17-18-12(10)15/h7,9H,3-6,8H2,1-2H3,(H,16,17) |
| InChIKey | VKMDSSNUVPWGKO-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.22 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |