C13H22ClN5O — CID 83039460
5-chloro-N-(2,2-diethyloxan-4-yl)-2-hydrazinylpyrimidin-4-amine (PubChem CID 83039460) has the molecular formula C13H22ClN5O and a molecular weight of 299.81 g/mol. Its IUPAC name is 5-chloro-N-(2,2-diethyloxan-4-yl)-2-hydrazinylpyrimidin-4-amine.
| Compound Name | 5-chloro-N-(2,2-diethyloxan-4-yl)-2-hydrazinylpyrimidin-4-amine |
|---|---|
| PubChem CID | 83039460 |
| Molecular Formula | C13H22ClN5O |
| Molecular Weight | 299.81 g/mol |
| Exact Mass | 299.15 |
| IUPAC Name | 5-chloro-N-(2,2-diethyloxan-4-yl)-2-hydrazinylpyrimidin-4-amine |
| SMILES | CCC1(CC)CC(Nc2nc(NN)ncc2Cl)CCO1 |
| InChI | InChI=1S/C13H22ClN5O/c1-3-13(4-2)7-9(5-6-20-13)17-11-10(14)8-16-12(18-11)19-15/h8-9H,3-7,15H2,1-2H3,(H2,16,17,18,19) |
| InChIKey | WEEUIPBNEZAMSO-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 85.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.81 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|