C15H21ClN2O3 — CID 83036892
5-chloro-6-[(2,2-diethyloxan-4-yl)amino]pyridine-3-carboxylic acid (PubChem CID 83036892) has the molecular formula C15H21ClN2O3 and a molecular weight of 312.80 g/mol. Its IUPAC name is 5-chloro-6-[(2,2-diethyloxan-4-yl)amino]pyridine-3-carboxylic acid.
| Compound Name | 5-chloro-6-[(2,2-diethyloxan-4-yl)amino]pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 83036892 |
| Molecular Formula | C15H21ClN2O3 |
| Molecular Weight | 312.80 g/mol |
| Exact Mass | 312.12 |
| IUPAC Name | 5-chloro-6-[(2,2-diethyloxan-4-yl)amino]pyridine-3-carboxylic acid |
| SMILES | CCC1(CC)CC(Nc2ncc(C(=O)O)cc2Cl)CCO1 |
| InChI | InChI=1S/C15H21ClN2O3/c1-3-15(4-2)8-11(5-6-21-15)18-13-12(16)7-10(9-17-13)14(19)20/h7,9,11H,3-6,8H2,1-2H3,(H,17,18)(H,19,20) |
| InChIKey | GZIRSKZEUCSUDF-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 71.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.80 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |