C14H19Cl3N2O — CID 102751716
3,5,6-trichloro-N-(2,2-diethyloxan-4-yl)pyridin-2-amine (PubChem CID 102751716) has the molecular formula C14H19Cl3N2O and a molecular weight of 337.68 g/mol. Its IUPAC name is 3,5,6-trichloro-N-(2,2-diethyloxan-4-yl)pyridin-2-amine.
| Compound Name | 3,5,6-trichloro-N-(2,2-diethyloxan-4-yl)pyridin-2-amine |
|---|---|
| PubChem CID | 102751716 |
| Molecular Formula | C14H19Cl3N2O |
| Molecular Weight | 337.68 g/mol |
| Exact Mass | 336.06 |
| IUPAC Name | 3,5,6-trichloro-N-(2,2-diethyloxan-4-yl)pyridin-2-amine |
| SMILES | CCC1(CC)CC(Nc2nc(Cl)c(Cl)cc2Cl)CCO1 |
| InChI | InChI=1S/C14H19Cl3N2O/c1-3-14(4-2)8-9(5-6-20-14)18-13-11(16)7-10(15)12(17)19-13/h7,9H,3-6,8H2,1-2H3,(H,18,19) |
| InChIKey | NOKORNLTOMZIFX-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.68 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|