C13H17Cl3N2 — CID 102750636
3,5,6-trichloro-N-(4-ethylcyclohexyl)pyridin-2-amine (PubChem CID 102750636) has the molecular formula C13H17Cl3N2 and a molecular weight of 307.65 g/mol. Its IUPAC name is 3,5,6-trichloro-N-(4-ethylcyclohexyl)pyridin-2-amine.
| Compound Name | 3,5,6-trichloro-N-(4-ethylcyclohexyl)pyridin-2-amine |
|---|---|
| PubChem CID | 102750636 |
| Molecular Formula | C13H17Cl3N2 |
| Molecular Weight | 307.65 g/mol |
| Exact Mass | 306.05 |
| IUPAC Name | 3,5,6-trichloro-N-(4-ethylcyclohexyl)pyridin-2-amine |
| SMILES | CCC1CCC(Nc2nc(Cl)c(Cl)cc2Cl)CC1 |
| InChI | InChI=1S/C13H17Cl3N2/c1-2-8-3-5-9(6-4-8)17-13-11(15)7-10(14)12(16)18-13/h7-9H,2-6H2,1H3,(H,17,18) |
| InChIKey | HGGCDMNJWSIKIJ-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.65 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|